CAS 1255718-04-7 is the registry number for [1-(2,5-Dimethyl-1,3-thiazol-4-yl)ethyl]amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.
1-(2,5-dimethyl-1,3-thiazol-4-yl)ethanamine;dihydrochloride (CAS 1255718-04-7) is a chemical compound with the molecular formula C7H14Cl2N2S and a molecular weight of 229.17 g/mol. IUPAC name: 1-(2,5-dimethyl-1,3-thiazol-4-yl)ethanamine;dihydrochloride. InChIKey: SBIWNHGRRGXRIO-UHFFFAOYSA-N.
| Molecular formula | C7H14Cl2N2S |
|---|---|
| Molecular weight | 229.17 g/mol |
| IUPAC name | 1-(2,5-dimethyl-1,3-thiazol-4-yl)ethanamine;dihydrochloride |
| InChIKey | SBIWNHGRRGXRIO-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)C)C(C)N.Cl.Cl |
Computed by PubChem (NCBI)