CAS 1255718-36-5 is the registry number for 1-Cyclopentyl-1,4-diazepane bis(4-methylbenzenesulfonate), 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
1-cyclopentyl-1,4-diazepane;bis(4-methylbenzenesulfonic acid) (CAS 1255718-36-5) is a chemical compound with the molecular formula C24H36N2O6S2 and a molecular weight of 512.7 g/mol. IUPAC name: 1-cyclopentyl-1,4-diazepane;bis(4-methylbenzenesulfonic acid). InChIKey: JGCATNMZNWTOKP-UHFFFAOYSA-N.
| Molecular formula | C24H36N2O6S2 |
|---|---|
| Molecular weight | 512.7 g/mol |
| IUPAC name | 1-cyclopentyl-1,4-diazepane;bis(4-methylbenzenesulfonic acid) |
| InChIKey | JGCATNMZNWTOKP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC1=CC=C(C=C1)S(=O)(=O)O.C1CCC(C1)N2CCCNCC2 |
Computed by PubChem (NCBI)