CAS 1255718-40-1 is the registry number for [(3-Isopropyl-1,2,4-oxadiazol-5-yl)methyl]methylamine trifluoroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
N-methyl-1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methanamine;2,2,2-trifluoroacetic acid (CAS 1255718-40-1) is a chemical compound with the molecular formula C9H14F3N3O3 and a molecular weight of 269.22 g/mol. IUPAC name: N-methyl-1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methanamine;2,2,2-trifluoroacetic acid. InChIKey: URNDIWSWIJYKQX-UHFFFAOYSA-N.
| Molecular formula | C9H14F3N3O3 |
|---|---|
| Molecular weight | 269.22 g/mol |
| IUPAC name | N-methyl-1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methanamine;2,2,2-trifluoroacetic acid |
| InChIKey | URNDIWSWIJYKQX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NOC(=N1)CNC.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)