CAS 1255789-22-0 appears in our catalog under these names: 2-Amino-1h-1,3-benzodiazol-7-ol, 95%, 2-Amino-1H-benzo(d)imidazol-4-ol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
2-amino-1H-benzimidazol-4-ol (CAS 1255789-22-0) is a chemical compound with the molecular formula C7H7N3O and a molecular weight of 149.15 g/mol. IUPAC name: 2-amino-1H-benzimidazol-4-ol. InChIKey: BBSYMXYQDPASMX-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O |
|---|---|
| Molecular weight | 149.15 g/mol |
| IUPAC name | 2-amino-1H-benzimidazol-4-ol |
| InChIKey | BBSYMXYQDPASMX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)N=C(N2)N |
Computed by PubChem (NCBI)