CAS 125579-40-0 appears in our catalog under these names: Celiprolol EP Impurity B, Celiprolol Impurity 2(Celiprolol EP Impurity B), N,N'-Bis(3-acetyl-4-(3-((1,1-dimethylethyl)amino)-2-hydroxypropoxy)phenyl)-urea, >95% (HPLC), N,N'-Bis(3-acetyl-4-(3-((1,1-dimethylethyl)amino)-2-hydroxypropoxy)phenyl)-urea. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
1,3-bis[3-acetyl-4-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]urea (CAS 125579-40-0) is a chemical compound with the molecular formula C31H46N4O7 and a molecular weight of 586.7 g/mol. IUPAC name: 1,3-bis[3-acetyl-4-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]urea. InChIKey: QPWPODQCWFCWKS-UHFFFAOYSA-N.
| Molecular formula | C31H46N4O7 |
|---|---|
| Molecular weight | 586.7 g/mol |
| IUPAC name | 1,3-bis[3-acetyl-4-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]urea |
| InChIKey | QPWPODQCWFCWKS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)NC(=O)NC2=CC(=C(C=C2)OCC(CNC(C)(C)C)O)C(=O)C)OCC(CNC(C)(C)C)O |
Computed by PubChem (NCBI)