CAS 1255871-55-6 appears in our catalog under these names: 6-Bromo-2-naphthamide, 98%, 6-Bromo-2-naphthamide, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
6-bromonaphthalene-2-carboxamide (CAS 1255871-55-6) is a chemical compound with the molecular formula C11H8BrNO and a molecular weight of 250.09 g/mol. IUPAC name: 6-bromonaphthalene-2-carboxamide. InChIKey: VPRQHJKFKCXNMV-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO |
|---|---|
| Molecular weight | 250.09 g/mol |
| IUPAC name | 6-bromonaphthalene-2-carboxamide |
| InChIKey | VPRQHJKFKCXNMV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Br)C=C1C(=O)N |
Computed by PubChem (NCBI)