Products 1255933-98-2
CAS 1255933-98-2 is the registry number for Trans-1-boc-4-m-tolylpyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
(3S,4R)-4-(3-methylphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 1255933-98-2) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: (3S,4R)-4-(3-methylphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: ITBNRQXFHZCACB-UONOGXRCSA-N.
| Molecular formula | C17H23NO4 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | (3S,4R)-4-(3-methylphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | ITBNRQXFHZCACB-UONOGXRCSA-N |
| SMILES | CC1=CC(=CC=C1)[C@@H]2CN(C[C@H]2C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)