CAS 1256037-60-1 appears in our catalog under these names: 2-(3-Fluorophenyl)-6-methoxy-4-oxo-1,4-dihydroquinolin-5-yl dihydrogen phosphate, 98%, Foslinanib. Offered by: Chemat Brand, TargetMol. Available pack sizes: on request, 25mg, 50mg, 100mg.
[2-(3-fluorophenyl)-6-methoxy-4-oxo-1H-quinolin-5-yl] dihydrogen phosphate (CAS 1256037-60-1) is a chemical compound with the molecular formula C16H13FNO6P and a molecular weight of 365.25 g/mol. IUPAC name: [2-(3-fluorophenyl)-6-methoxy-4-oxo-1H-quinolin-5-yl] dihydrogen phosphate. InChIKey: ZDWFMAHQGDEALT-UHFFFAOYSA-N.
| Molecular formula | C16H13FNO6P |
|---|---|
| Molecular weight | 365.25 g/mol |
| IUPAC name | [2-(3-fluorophenyl)-6-methoxy-4-oxo-1H-quinolin-5-yl] dihydrogen phosphate |
| InChIKey | ZDWFMAHQGDEALT-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)NC(=CC2=O)C3=CC(=CC=C3)F)OP(=O)(O)O |
Computed by PubChem (NCBI)