CAS 1256037-62-3 appears in our catalog under these names: TRX–818 (sodium salt), Foslinanib Sodium/ 97.52% (existing batch purity), TRX-818 (sodium salt), TRX-818 (sodium salt), 99%. Offered by: GLPBio, TargetMol, Chemat, Ambeed. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 50mg, 100mg, 200mg.
Disodium;[2-(3-fluorophenyl)-6-methoxy-4-oxo-1H-quinolin-5-yl] phosphate (CAS 1256037-62-3) is a chemical compound with the molecular formula C16H11FNNa2O6P and a molecular weight of 409.21 g/mol. IUPAC name: disodium;[2-(3-fluorophenyl)-6-methoxy-4-oxo-1H-quinolin-5-yl] phosphate. InChIKey: TWMCXXQLLQDSTN-UHFFFAOYSA-L.
| Molecular formula | C16H11FNNa2O6P |
|---|---|
| Molecular weight | 409.21 g/mol |
| IUPAC name | disodium;[2-(3-fluorophenyl)-6-methoxy-4-oxo-1H-quinolin-5-yl] phosphate |
| InChIKey | TWMCXXQLLQDSTN-UHFFFAOYSA-L |
| SMILES | COC1=C(C2=C(C=C1)NC(=CC2=O)C3=CC(=CC=C3)F)OP(=O)([O-])[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)