CAS 1256256-45-7 appears in our catalog under these names: 4-(Boc-amino)-2-fluorobenzeneboronic acid pinacol ester, 96%, 4-(BOC-Amino)-2-fluorophenylboronic acid pinacol ester, 97%, 97%, (4-((TERT-BUTOXYCARBONYL)AMINO)-2-FLUOROPHENYL)BORONIC ACID PINACOL ESTER, 96%, tert-Butyl (3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)carbamate, 97%. Offered by: Thermo Scientific (Alfa Aesar), Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 25g.
Tert-butyl N-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 1256256-45-7) is a chemical compound with the molecular formula C17H25BFNO4 and a molecular weight of 337.2 g/mol. IUPAC name: tert-butyl N-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: FALNYBWTRBHWID-UHFFFAOYSA-N.
| Molecular formula | C17H25BFNO4 |
|---|---|
| Molecular weight | 337.2 g/mol |
| IUPAC name | tert-butyl N-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | FALNYBWTRBHWID-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)NC(=O)OC(C)(C)C)F |
Computed by PubChem (NCBI)