Products 125631-33-6

CAS 125631-33-6 is the registry number for PENT-4-ENYL-D-GLUCOPYRANOSIDE. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 250mg, 100mg, 500mg, 1000mg.

Structural formula: {0} (CAS {1})

(2R,3S,4S,5R)-2-(hydroxymethyl)-6-pent-4-enoxyoxane-3,4,5-triol (CAS 125631-33-6) is a chemical compound with the molecular formula C11H20O6 and a molecular weight of 248.27 g/mol. IUPAC name: (2R,3S,4S,5R)-2-(hydroxymethyl)-6-pent-4-enoxyoxane-3,4,5-triol. InChIKey: NIFLCEUASFWSRL-YBTJCZCISA-N.

Identity
Molecular formulaC11H20O6
Molecular weight248.27 g/mol
IUPAC name(2R,3S,4S,5R)-2-(hydroxymethyl)-6-pent-4-enoxyoxane-3,4,5-triol
InChIKeyNIFLCEUASFWSRL-YBTJCZCISA-N
SMILESC=CCCCOC1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O

Computed by PubChem (NCBI)