CAS 125631-33-6 is the registry number for PENT-4-ENYL-D-GLUCOPYRANOSIDE. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 250mg, 100mg, 500mg, 1000mg.
(2R,3S,4S,5R)-2-(hydroxymethyl)-6-pent-4-enoxyoxane-3,4,5-triol (CAS 125631-33-6) is a chemical compound with the molecular formula C11H20O6 and a molecular weight of 248.27 g/mol. IUPAC name: (2R,3S,4S,5R)-2-(hydroxymethyl)-6-pent-4-enoxyoxane-3,4,5-triol. InChIKey: NIFLCEUASFWSRL-YBTJCZCISA-N.
| Molecular formula | C11H20O6 |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-pent-4-enoxyoxane-3,4,5-triol |
| InChIKey | NIFLCEUASFWSRL-YBTJCZCISA-N |
| SMILES | C=CCCCOC1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)