CAS 1256345-63-7 appears in our catalog under these names: 4-Acetyl-3-nitrophenylboronic acid, 98%, (4-Acetyl-3-nitrophenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
(4-acetyl-3-nitrophenyl)boronic acid (CAS 1256345-63-7) is a chemical compound with the molecular formula C8H8BNO5 and a molecular weight of 208.97 g/mol. IUPAC name: (4-acetyl-3-nitrophenyl)boronic acid. InChIKey: PZXBGJTWRHMQQR-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO5 |
|---|---|
| Molecular weight | 208.97 g/mol |
| IUPAC name | (4-acetyl-3-nitrophenyl)boronic acid |
| InChIKey | PZXBGJTWRHMQQR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)C)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)