CAS 1256345-65-9 is the registry number for 3-Methylpyridine-2-boronic acid, monolithium salt, 90%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Lithium hydroxy-(3-methyl-2-pyridinyl)borinate (CAS 1256345-65-9) is a chemical compound with the molecular formula C6H7BLiNO2 and a molecular weight of 142.9 g/mol. IUPAC name: lithium hydroxy-(3-methyl-2-pyridinyl)borinate. InChIKey: PZIPQENZVYUENU-UHFFFAOYSA-N.
| Molecular formula | C6H7BLiNO2 |
|---|---|
| Molecular weight | 142.9 g/mol |
| IUPAC name | lithium hydroxy-(3-methyl-2-pyridinyl)borinate |
| InChIKey | PZIPQENZVYUENU-UHFFFAOYSA-N |
| SMILES | [Li+].B(C1=C(C=CC=N1)C)(O)[O-] |
Computed by PubChem (NCBI)