CAS 1256345-83-1 is the registry number for 4-(Ethoxycarbonyldifluoromethyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[4-(2-ethoxy-1,1-difluoro-2-oxoethyl)phenyl]boronic acid (CAS 1256345-83-1) is a chemical compound with the molecular formula C10H11BF2O4 and a molecular weight of 244.00 g/mol. IUPAC name: [4-(2-ethoxy-1,1-difluoro-2-oxoethyl)phenyl]boronic acid. InChIKey: KCHICHVWFDSXLJ-UHFFFAOYSA-N.
| Molecular formula | C10H11BF2O4 |
|---|---|
| Molecular weight | 244.00 g/mol |
| IUPAC name | [4-(2-ethoxy-1,1-difluoro-2-oxoethyl)phenyl]boronic acid |
| InChIKey | KCHICHVWFDSXLJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(C(=O)OCC)(F)F)(O)O |
Computed by PubChem (NCBI)