CAS 1256345-90-0 appears in our catalog under these names: 6-(Isopropylthio)pyridine-3-boronic acid, 98%, (6-(Isopropylthio)pyridin-3-yl)boronic acid 98%, (6-(Isopropylthio)pyridin-3-yl)boronic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 10g, 1g, 25g, 250mg.
(6-propan-2-ylsulfanyl-3-pyridinyl)boronic acid (CAS 1256345-90-0) is a chemical compound with the molecular formula C8H12BNO2S and a molecular weight of 197.07 g/mol. IUPAC name: (6-propan-2-ylsulfanyl-3-pyridinyl)boronic acid. InChIKey: AHEICUZDZXGHOQ-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO2S |
|---|---|
| Molecular weight | 197.07 g/mol |
| IUPAC name | (6-propan-2-ylsulfanyl-3-pyridinyl)boronic acid |
| InChIKey | AHEICUZDZXGHOQ-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)SC(C)C)(O)O |
Computed by PubChem (NCBI)