Products 1256354-95-6

CAS 1256354-95-6 is the registry number for 2-Butoxy-5-methyl-1,3-phenylenediboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

(3-borono-2-butoxy-5-methylphenyl)boronic acid (CAS 1256354-95-6) is a chemical compound with the molecular formula C11H18B2O5 and a molecular weight of 251.9 g/mol. IUPAC name: (3-borono-2-butoxy-5-methylphenyl)boronic acid. InChIKey: VYGSXRMCYRFRHS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18B2O5
Molecular weight251.9 g/mol
IUPAC name(3-borono-2-butoxy-5-methylphenyl)boronic acid
InChIKeyVYGSXRMCYRFRHS-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1OCCCC)B(O)O)C)(O)O

Computed by PubChem (NCBI)