CAS 1256354-96-7 appears in our catalog under these names: 2,4-Dichloro-5-(trifluoromethoxy)phenylboronic acid, 98%, (2,4-Dichloro-5-(trifluoromethoxy)phenyl)boronic acid 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 100mg, 50mg, 1g.
[2,4-dichloro-5-(trifluoromethoxy)phenyl]boronic acid (CAS 1256354-96-7) is a chemical compound with the molecular formula C7H4BCl2F3O3 and a molecular weight of 274.82 g/mol. IUPAC name: [2,4-dichloro-5-(trifluoromethoxy)phenyl]boronic acid. InChIKey: VERJOIRDTSZURH-UHFFFAOYSA-N.
| Molecular formula | C7H4BCl2F3O3 |
|---|---|
| Molecular weight | 274.82 g/mol |
| IUPAC name | [2,4-dichloro-5-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | VERJOIRDTSZURH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)Cl)OC(F)(F)F)(O)O |
Computed by PubChem (NCBI)