CAS 1256355-16-4 appears in our catalog under these names: 3-Bromo-5-pyrrolidinophenylboronic acid, 95%, 3-Bromo-5-pyrrolidinophenylboronic Acid, >95% (HPLC). Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 1g, 100mg, 250mg, 50mg.
(3-bromo-5-pyrrolidin-1-ylphenyl)boronic acid (CAS 1256355-16-4) is a chemical compound with the molecular formula C10H13BBrNO2 and a molecular weight of 269.93 g/mol. IUPAC name: (3-bromo-5-pyrrolidin-1-ylphenyl)boronic acid. InChIKey: IDBGWBMXFPQRRD-UHFFFAOYSA-N.
| Molecular formula | C10H13BBrNO2 |
|---|---|
| Molecular weight | 269.93 g/mol |
| IUPAC name | (3-bromo-5-pyrrolidin-1-ylphenyl)boronic acid |
| InChIKey | IDBGWBMXFPQRRD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)N2CCCC2)(O)O |
Computed by PubChem (NCBI)