CAS 1256355-24-4 appears in our catalog under these names: 2-(Dimethylamino)pyridine-5-boronic acid, hydrate, 96%, (6-(Dimethylamino)pyridin-3-yl)boronic acid hydrate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
[6-(dimethylamino)-3-pyridinyl]boronic acid;hydrate (CAS 1256355-24-4) is a chemical compound with the molecular formula C7H13BN2O3 and a molecular weight of 184.00 g/mol. IUPAC name: [6-(dimethylamino)-3-pyridinyl]boronic acid;hydrate. InChIKey: KIAVEKTZSDRSQT-UHFFFAOYSA-N.
| Molecular formula | C7H13BN2O3 |
|---|---|
| Molecular weight | 184.00 g/mol |
| IUPAC name | [6-(dimethylamino)-3-pyridinyl]boronic acid;hydrate |
| InChIKey | KIAVEKTZSDRSQT-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)N(C)C)(O)O.O |
Computed by PubChem (NCBI)