Products 1256355-25-5

CAS 1256355-25-5 is the registry number for 2-Methoxypyridine-3-boronic acid hydrate, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.

Structural formula: {0} (CAS {1})

(2-methoxy-3-pyridinyl)boronic acid;hydrate (CAS 1256355-25-5) is a chemical compound with the molecular formula C6H10BNO4 and a molecular weight of 170.96 g/mol. IUPAC name: (2-methoxy-3-pyridinyl)boronic acid;hydrate. InChIKey: DHHSGONJRVICQW-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10BNO4
Molecular weight170.96 g/mol
IUPAC name(2-methoxy-3-pyridinyl)boronic acid;hydrate
InChIKeyDHHSGONJRVICQW-UHFFFAOYSA-N
SMILESB(C1=C(N=CC=C1)OC)(O)O.O

Computed by PubChem (NCBI)