CAS 1256355-29-9 appears in our catalog under these names: 2-(4-Methylpiperazino)pyrimidine-5-boronic acid, 97%, (2-(4-Methylpiperazin-1-yl)pyrimidin-5-yl)boronic acid, 95%, 95%, 2-(4-Methylpiperazino)pyrimidine-5-boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
[2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]boronic acid (CAS 1256355-29-9) is a chemical compound with the molecular formula C9H15BN4O2 and a molecular weight of 222.05 g/mol. IUPAC name: [2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]boronic acid. InChIKey: FEYYRRPONOKNQL-UHFFFAOYSA-N.
| Molecular formula | C9H15BN4O2 |
|---|---|
| Molecular weight | 222.05 g/mol |
| IUPAC name | [2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]boronic acid |
| InChIKey | FEYYRRPONOKNQL-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1)N2CCN(CC2)C)(O)O |
Computed by PubChem (NCBI)