CAS 1256359-95-1 appears in our catalog under these names: 6-Methoxyindole-2-boronic acid, pinacol ester, 97%, 6-Methoxyindole-2-boronic acid, pinacol ester, 97%, 97%, 6-Methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g.
6-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (CAS 1256359-95-1) is a chemical compound with the molecular formula C15H20BNO3 and a molecular weight of 273.14 g/mol. IUPAC name: 6-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole. InChIKey: FMNQSETUJNXLBW-UHFFFAOYSA-N.
| Molecular formula | C15H20BNO3 |
|---|---|
| Molecular weight | 273.14 g/mol |
| IUPAC name | 6-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| InChIKey | FMNQSETUJNXLBW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N2)C=C(C=C3)OC |
Computed by PubChem (NCBI)