CAS 1256359-98-4 appears in our catalog under these names: 2-Cbz-Aminopyrimidine-5-boronic acid, pinacol ester, 98%, Benzyl (5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl)carbamate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg.
Benzyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]carbamate (CAS 1256359-98-4) is a chemical compound with the molecular formula C18H22BN3O4 and a molecular weight of 355.2 g/mol. IUPAC name: benzyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]carbamate. InChIKey: NZIYVGONUAHWNB-UHFFFAOYSA-N.
| Molecular formula | C18H22BN3O4 |
|---|---|
| Molecular weight | 355.2 g/mol |
| IUPAC name | benzyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]carbamate |
| InChIKey | NZIYVGONUAHWNB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)