Products 1256360-00-5
CAS 1256360-00-5 appears in our catalog under these names: tert-Butyl 6-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-1-carboxylate, 95%, 1-Boc-6-methoxyindole-3-boronic acid pinacol ester, 97%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl 6-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (CAS 1256360-00-5) is a chemical compound with the molecular formula C20H28BNO5 and a molecular weight of 373.3 g/mol. IUPAC name: tert-butyl 6-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate. InChIKey: NEVYMHCTIQBRQU-UHFFFAOYSA-N.
| Molecular formula | C20H28BNO5 |
|---|---|
| Molecular weight | 373.3 g/mol |
| IUPAC name | tert-butyl 6-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| InChIKey | NEVYMHCTIQBRQU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C3=C2C=CC(=C3)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)