CAS 1256360-22-1 appears in our catalog under these names: 5-Methoxyindole--2,7-diboronic acid, pinacol ester, 96%, 5-Methoxyindole--2,7-diboronic acid, pinacol ester, 98%, 98%, 5-Methoxy-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
5-methoxy-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (CAS 1256360-22-1) is a chemical compound with the molecular formula C21H31B2NO5 and a molecular weight of 399.1 g/mol. IUPAC name: 5-methoxy-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole. InChIKey: OEKIATPCAQZJSA-UHFFFAOYSA-N.
| Molecular formula | C21H31B2NO5 |
|---|---|
| Molecular weight | 399.1 g/mol |
| IUPAC name | 5-methoxy-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| InChIKey | OEKIATPCAQZJSA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC3=C2NC(=C3)B4OC(C(O4)(C)C)(C)C)OC |
Computed by PubChem (NCBI)