CAS 1256360-27-6 is the registry number for 4-Methoxy-3-(methylsulfonylamino)phenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide (CAS 1256360-27-6) is a chemical compound with the molecular formula C14H22BNO5S and a molecular weight of 327.2 g/mol. IUPAC name: N-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide. InChIKey: NZSTWDFNWRRIAK-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO5S |
|---|---|
| Molecular weight | 327.2 g/mol |
| IUPAC name | N-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide |
| InChIKey | NZSTWDFNWRRIAK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OC)NS(=O)(=O)C |
Computed by PubChem (NCBI)