CAS 1256360-32-3 appears in our catalog under these names: 2,4-Dichloro-5-hydroxyphenylboronic acid, pinacol ester, 98%, 2,4-Dichloro-5-hydroxyphenylboronic acid, pinacol ester, 98%, 98%, 2,4-Dichloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
2,4-dichloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1256360-32-3) is a chemical compound with the molecular formula C12H15BCl2O3 and a molecular weight of 289.0 g/mol. IUPAC name: 2,4-dichloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: VMORPTCOJVWIHG-UHFFFAOYSA-N.
| Molecular formula | C12H15BCl2O3 |
|---|---|
| Molecular weight | 289.0 g/mol |
| IUPAC name | 2,4-dichloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | VMORPTCOJVWIHG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2Cl)Cl)O |
Computed by PubChem (NCBI)