CAS 1256360-35-6 is the registry number for 2-N-Benzylamino-3-nitrophenylboronic acid, pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-benzyl-2-nitro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1256360-35-6) is a chemical compound with the molecular formula C19H23BN2O4 and a molecular weight of 354.2 g/mol. IUPAC name: N-benzyl-2-nitro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: NDECCQMBNWZQTQ-UHFFFAOYSA-N.
| Molecular formula | C19H23BN2O4 |
|---|---|
| Molecular weight | 354.2 g/mol |
| IUPAC name | N-benzyl-2-nitro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | NDECCQMBNWZQTQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)[N+](=O)[O-])NCC3=CC=CC=C3 |
Computed by PubChem (NCBI)