CAS 1256364-41-6 is the registry number for Lithium triisopropyl 2-(6-chloropyridyl)borate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Lithium (6-chloro-2-pyridinyl)-tri(propan-2-yloxy)boranuide (CAS 1256364-41-6) is a chemical compound with the molecular formula C14H24BClLiNO3 and a molecular weight of 307.6 g/mol. IUPAC name: lithium (6-chloro-2-pyridinyl)-tri(propan-2-yloxy)boranuide. InChIKey: NCCGRSWODPTLLF-UHFFFAOYSA-N.
| Molecular formula | C14H24BClLiNO3 |
|---|---|
| Molecular weight | 307.6 g/mol |
| IUPAC name | lithium (6-chloro-2-pyridinyl)-tri(propan-2-yloxy)boranuide |
| InChIKey | NCCGRSWODPTLLF-UHFFFAOYSA-N |
| SMILES | [Li+].[B-](C1=NC(=CC=C1)Cl)(OC(C)C)(OC(C)C)OC(C)C |
Computed by PubChem (NCBI)