CAS 1256490-48-8 is the registry number for N-((4-Nitrophenoxy)phenoxyphosphinyl)-L-alanine 1-Methylethyl Ester (Mixture). Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
Propan-2-yl (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate (CAS 1256490-48-8) is a chemical compound with the molecular formula C18H21N2O7P and a molecular weight of 408.3 g/mol. IUPAC name: propan-2-yl (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate. InChIKey: NYJKISSOEZMRHH-DCXKMBIZSA-N.
| Molecular formula | C18H21N2O7P |
|---|---|
| Molecular weight | 408.3 g/mol |
| IUPAC name | propan-2-yl (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate |
| InChIKey | NYJKISSOEZMRHH-DCXKMBIZSA-N |
| SMILES | C[C@@H](C(=O)OC(C)C)NP(=O)(OC1=CC=CC=C1)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)