CAS 125652-40-6 appears in our catalog under these names: Bz-dl-arg-oh hydrochloride, 98%, BZ–DL–ARG–OH Hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 100mg.
(2S)-2-benzamido-5-(diaminomethylideneamino)pentanoic acid;hydrochloride (CAS 125652-40-6) is a chemical compound with the molecular formula C13H19ClN4O3 and a molecular weight of 314.77 g/mol. IUPAC name: (2S)-2-benzamido-5-(diaminomethylideneamino)pentanoic acid;hydrochloride. InChIKey: LSLUHKRVLRTIBV-PPHPATTJSA-N.
| Molecular formula | C13H19ClN4O3 |
|---|---|
| Molecular weight | 314.77 g/mol |
| IUPAC name | (2S)-2-benzamido-5-(diaminomethylideneamino)pentanoic acid;hydrochloride |
| InChIKey | LSLUHKRVLRTIBV-PPHPATTJSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O.Cl |
Computed by PubChem (NCBI)