Products 125652-47-3
CAS 125652-47-3 is the registry number for CGP 31358. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[4-[2-(4-chlorophenyl)propan-2-yl]-2-methoxyphenyl]-1,2,4-triazole-3-carboxamide (CAS 125652-47-3) is a chemical compound with the molecular formula C19H19ClN4O2 and a molecular weight of 370.8 g/mol. IUPAC name: 1-[4-[2-(4-chlorophenyl)propan-2-yl]-2-methoxyphenyl]-1,2,4-triazole-3-carboxamide. InChIKey: STTFFDLZKCMBQO-UHFFFAOYSA-N.
| Molecular formula | C19H19ClN4O2 |
|---|---|
| Molecular weight | 370.8 g/mol |
| IUPAC name | 1-[4-[2-(4-chlorophenyl)propan-2-yl]-2-methoxyphenyl]-1,2,4-triazole-3-carboxamide |
| InChIKey | STTFFDLZKCMBQO-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)Cl)C2=CC(=C(C=C2)N3C=NC(=N3)C(=O)N)OC |
Computed by PubChem (NCBI)