CAS 1256584-74-3 appears in our catalog under these names: tert-Butyl 4-(4-ethyl-3-iodophenyl)-4-methyl-3-oxopentanoate, 97%, Alectinib Impurity 5, Alectinib Impurity 4. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Tert-butyl 4-(4-ethyl-3-iodophenyl)-4-methyl-3-oxopentanoate (CAS 1256584-74-3) is a chemical compound with the molecular formula C18H25IO3 and a molecular weight of 416.3 g/mol. IUPAC name: tert-butyl 4-(4-ethyl-3-iodophenyl)-4-methyl-3-oxopentanoate. InChIKey: HTOKKYUVGMHADM-UHFFFAOYSA-N.
| Molecular formula | C18H25IO3 |
|---|---|
| Molecular weight | 416.3 g/mol |
| IUPAC name | tert-butyl 4-(4-ethyl-3-iodophenyl)-4-methyl-3-oxopentanoate |
| InChIKey | HTOKKYUVGMHADM-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C(C=C1)C(C)(C)C(=O)CC(=O)OC(C)(C)C)I |
Computed by PubChem (NCBI)