Products 1256628-02-0

CAS 1256628-02-0 is the registry number for Methyl 2,4-dioxo-6-(2-thienyl)cyclohexanecarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2,4-dioxo-6-thiophen-2-ylcyclohexane-1-carboxylate (CAS 1256628-02-0) is a chemical compound with the molecular formula C12H12O4S and a molecular weight of 252.29 g/mol. IUPAC name: methyl 2,4-dioxo-6-thiophen-2-ylcyclohexane-1-carboxylate. InChIKey: BGOFBJYATGXJII-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12O4S
Molecular weight252.29 g/mol
IUPAC namemethyl 2,4-dioxo-6-thiophen-2-ylcyclohexane-1-carboxylate
InChIKeyBGOFBJYATGXJII-UHFFFAOYSA-N
SMILESCOC(=O)C1C(CC(=O)CC1=O)C2=CC=CS2

Computed by PubChem (NCBI)