CAS 1256643-17-0 appears in our catalog under these names: (3-Endo)-3-methoxy-8-azabicyclo[3.2.1]octane hydrochloride, 95%, (3-Endo)-3-methoxy-8-azabicyclo[3.2.1]octane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(1S,5R)-3-methoxy-8-azabicyclo[3.2.1]octane (CAS 1256643-17-0) is a chemical compound with the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. IUPAC name: (1S,5R)-3-methoxy-8-azabicyclo[3.2.1]octane. InChIKey: GPCOICWXCKOIEM-DHBOJHSNSA-N.
| Molecular formula | C8H15NO |
|---|---|
| Molecular weight | 141.21 g/mol |
| IUPAC name | (1S,5R)-3-methoxy-8-azabicyclo[3.2.1]octane |
| InChIKey | GPCOICWXCKOIEM-DHBOJHSNSA-N |
| SMILES | COC1C[C@H]2CC[C@@H](C1)N2 |
Computed by PubChem (NCBI)