Products 1256776-89-2
CAS 1256776-89-2 appears in our catalog under these names: FSHR agonist 1, FSHR agonist 1, 99.45%, FSHR agonist 1, 98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 5mg, 50 mg, 10 mg, 1 mg, 5 mg, 25 mg, 100 mg.
N-tert-butyl-N-ethyl-8-methoxy-9-propan-2-yloxy-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline-3-carboxamide (CAS 1256776-89-2) is a chemical compound with the molecular formula C26H33N3O3S and a molecular weight of 467.6 g/mol. IUPAC name: N-tert-butyl-N-ethyl-8-methoxy-9-propan-2-yloxy-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline-3-carboxamide. InChIKey: DNSWBPOFBBWYJX-UHFFFAOYSA-N.
| Molecular formula | C26H33N3O3S |
|---|---|
| Molecular weight | 467.6 g/mol |
| IUPAC name | N-tert-butyl-N-ethyl-8-methoxy-9-propan-2-yloxy-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline-3-carboxamide |
| InChIKey | DNSWBPOFBBWYJX-UHFFFAOYSA-N |
| SMILES | CCN(C(=O)C1=NC(=C2N1CCC3=CC(=C(C=C32)OC(C)C)OC)C4=CC=CS4)C(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
FSHR agonist 1, orb1744634