CAS 1256781-71-1 is the registry number for 4-Iodo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-iodo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1256781-71-1) is a chemical compound with the molecular formula C12H16BIO3 and a molecular weight of 345.97 g/mol. IUPAC name: 4-iodo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: QLZQKMXNNCBLSI-UHFFFAOYSA-N.
| Molecular formula | C12H16BIO3 |
|---|---|
| Molecular weight | 345.97 g/mol |
| IUPAC name | 4-iodo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | QLZQKMXNNCBLSI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)O)I |
Computed by PubChem (NCBI)