Products 1256789-37-3
CAS 1256789-37-3 appears in our catalog under these names: 5-Bromo-4-chlorofuro[2,3-d]pyrimidine, 95%, 5-bromo-4-chlorofuro(2,3-d)pyrimidine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
5-bromo-4-chlorofuro[2,3-d]pyrimidine (CAS 1256789-37-3) is a chemical compound with the molecular formula C6H2BrClN2O and a molecular weight of 233.45 g/mol. IUPAC name: 5-bromo-4-chlorofuro[2,3-d]pyrimidine. InChIKey: NDOLFTQSUWAOKB-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClN2O |
|---|---|
| Molecular weight | 233.45 g/mol |
| IUPAC name | 5-bromo-4-chlorofuro[2,3-d]pyrimidine |
| InChIKey | NDOLFTQSUWAOKB-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(O1)N=CN=C2Cl)Br |
Computed by PubChem (NCBI)