Products 1256822-15-7

CAS 1256822-15-7 is the registry number for Methyl 3-fluoro-6-methylpyridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Methyl 3-fluoro-6-methylpyridine-2-carboxylate (CAS 1256822-15-7) is a chemical compound with the molecular formula C8H8FNO2 and a molecular weight of 169.15 g/mol. IUPAC name: methyl 3-fluoro-6-methylpyridine-2-carboxylate. InChIKey: KBHAWHDZQVRDHM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8FNO2
Molecular weight169.15 g/mol
IUPAC namemethyl 3-fluoro-6-methylpyridine-2-carboxylate
InChIKeyKBHAWHDZQVRDHM-UHFFFAOYSA-N
SMILESCC1=NC(=C(C=C1)F)C(=O)OC

Computed by PubChem (NCBI)