CAS 1256842-51-9 appears in our catalog under these names: N-Propionylglycine-2,2-d2, N-Propionylglycine-2,2-d2, 98 atom % D, min 98% Chemical Purity, N–Propionylglycine–2,2–d2, N-Propionylglycine-2,2-d2, 95.0%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, 0,05g, 0,01g, 1 mg.
2,2-dideuterio-2-(propanoylamino)acetic acid (CAS 1256842-51-9) is a chemical compound with the molecular formula C5H9NO3 and a molecular weight of 133.14 g/mol. IUPAC name: 2,2-dideuterio-2-(propanoylamino)acetic acid. InChIKey: WOMAZEJKVZLLFE-SMZGMGDZSA-N.
| Molecular formula | C5H9NO3 |
|---|---|
| Molecular weight | 133.14 g/mol |
| IUPAC name | 2,2-dideuterio-2-(propanoylamino)acetic acid |
| InChIKey | WOMAZEJKVZLLFE-SMZGMGDZSA-N |
| SMILES | [2H]C([2H])(C(=O)O)NC(=O)CC |
Computed by PubChem (NCBI)