CAS 1256842-52-0 appears in our catalog under these names: N-Hexanoylglycine-2,2-d2, 98 atom % D, min 98% Chemical Purity, Hexanoylglycine–d2, Hexanoylglycine-d2, 98.0%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 10mg, 50 mg, 100 mg, 10 mg, 5 mg, 25 mg.
Carboxymethyl-dideuterio-hexanoylazanium (CAS 1256842-52-0) is a chemical compound with the molecular formula C8H16NO3+ and a molecular weight of 176.23 g/mol. IUPAC name: carboxymethyl-dideuterio-hexanoylazanium. InChIKey: UPCKIPHSXMXJOX-ZSJDYOACSA-O.
| Molecular formula | C8H16NO3+ |
|---|---|
| Molecular weight | 176.23 g/mol |
| IUPAC name | carboxymethyl-dideuterio-hexanoylazanium |
| InChIKey | UPCKIPHSXMXJOX-ZSJDYOACSA-O |
| SMILES | [2H][N+]([2H])(CC(=O)O)C(=O)CCCCC |
Computed by PubChem (NCBI)