CAS 125687-18-5 is the registry number for Phenylhydrazine-d5 Hydrochloride (Major), >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg.
(2,3,4,5,6-pentadeuteriophenyl)hydrazine;hydrochloride (CAS 125687-18-5) is a chemical compound with the molecular formula C6H9ClN2 and a molecular weight of 149.63 g/mol. IUPAC name: (2,3,4,5,6-pentadeuteriophenyl)hydrazine;hydrochloride. InChIKey: JOVOSQBPPZZESK-GWVWGMRQSA-N.
| Molecular formula | C6H9ClN2 |
|---|---|
| Molecular weight | 149.63 g/mol |
| IUPAC name | (2,3,4,5,6-pentadeuteriophenyl)hydrazine;hydrochloride |
| InChIKey | JOVOSQBPPZZESK-GWVWGMRQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NN)[2H])[2H].Cl |
Computed by PubChem (NCBI)