Products 1256914-07-4

CAS 1256914-07-4 appears in our catalog under these names: 5-Bromo-2-fluoro-3-pyridinecarbonyl chloride, 95%, 5-Bromo-2-fluoronicotinoyl chloride 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 25g, 100g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-bromo-2-fluoropyridine-3-carbonyl chloride (CAS 1256914-07-4) is a chemical compound with the molecular formula C6H2BrClFNO and a molecular weight of 238.44 g/mol. IUPAC name: 5-bromo-2-fluoropyridine-3-carbonyl chloride. InChIKey: PGGDVNPCOYRXRM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2BrClFNO
Molecular weight238.44 g/mol
IUPAC name5-bromo-2-fluoropyridine-3-carbonyl chloride
InChIKeyPGGDVNPCOYRXRM-UHFFFAOYSA-N
SMILESC1=C(C=NC(=C1C(=O)Cl)F)Br

Computed by PubChem (NCBI)