CAS 1256914-07-4 appears in our catalog under these names: 5-Bromo-2-fluoro-3-pyridinecarbonyl chloride, 95%, 5-Bromo-2-fluoronicotinoyl chloride 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 25g, 100g, 5g, 1g, 250mg.
5-bromo-2-fluoropyridine-3-carbonyl chloride (CAS 1256914-07-4) is a chemical compound with the molecular formula C6H2BrClFNO and a molecular weight of 238.44 g/mol. IUPAC name: 5-bromo-2-fluoropyridine-3-carbonyl chloride. InChIKey: PGGDVNPCOYRXRM-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClFNO |
|---|---|
| Molecular weight | 238.44 g/mol |
| IUPAC name | 5-bromo-2-fluoropyridine-3-carbonyl chloride |
| InChIKey | PGGDVNPCOYRXRM-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)Cl)F)Br |
Computed by PubChem (NCBI)