CAS 1256935-81-5 is the registry number for 6,13-BIS(DIBROMOMETHYLENE)-6,13-DIHYDROPENTACENE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6,13-bis(dibromomethylidene)pentacene (CAS 1256935-81-5) is a chemical compound with the molecular formula C24H12Br4 and a molecular weight of 620.0 g/mol. IUPAC name: 6,13-bis(dibromomethylidene)pentacene. InChIKey: SUDPMACWXAJKHN-UHFFFAOYSA-N.
| Molecular formula | C24H12Br4 |
|---|---|
| Molecular weight | 620.0 g/mol |
| IUPAC name | 6,13-bis(dibromomethylidene)pentacene |
| InChIKey | SUDPMACWXAJKHN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C(=C(Br)Br)C4=CC5=CC=CC=C5C=C4C3=C(Br)Br |
Computed by PubChem (NCBI)