CAS 125722-16-9 is the registry number for Enofelast. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(E)-2-(4-fluorophenyl)ethenyl]-2,6-dimethylphenol (CAS 125722-16-9) is a chemical compound with the molecular formula C16H15FO and a molecular weight of 242.29 g/mol. IUPAC name: 4-[(E)-2-(4-fluorophenyl)ethenyl]-2,6-dimethylphenol. InChIKey: HJGJDFXTHQBVNV-ONEGZZNKSA-N.
| Molecular formula | C16H15FO |
|---|---|
| Molecular weight | 242.29 g/mol |
| IUPAC name | 4-[(E)-2-(4-fluorophenyl)ethenyl]-2,6-dimethylphenol |
| InChIKey | HJGJDFXTHQBVNV-ONEGZZNKSA-N |
| SMILES | CC1=CC(=CC(=C1O)C)/C=C/C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)