CAS 1257323-84-4 appears in our catalog under these names: NPEC-caged-(S)-AMPA, 98%, NPEC-caged-(S)-AMPA, NPEC–caged–(S)–AMPA. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 50mg, 10mg, Get quote.
(2S)-3-(5-methyl-3-oxo-1,2-oxazol-4-yl)-2-[1-(2-nitrophenyl)ethoxycarbonylamino]propanoic acid (CAS 1257323-84-4) is a chemical compound with the molecular formula C16H17N3O8 and a molecular weight of 379.32 g/mol. IUPAC name: (2S)-3-(5-methyl-3-oxo-1,2-oxazol-4-yl)-2-[1-(2-nitrophenyl)ethoxycarbonylamino]propanoic acid. InChIKey: LGVJRWDYNJZRRP-MYIOLCAUSA-N.
| Molecular formula | C16H17N3O8 |
|---|---|
| Molecular weight | 379.32 g/mol |
| IUPAC name | (2S)-3-(5-methyl-3-oxo-1,2-oxazol-4-yl)-2-[1-(2-nitrophenyl)ethoxycarbonylamino]propanoic acid |
| InChIKey | LGVJRWDYNJZRRP-MYIOLCAUSA-N |
| SMILES | CC1=C(C(=O)NO1)C[C@@H](C(=O)O)NC(=O)OC(C)C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)