CAS 1257329-76-2 is the registry number for 5-(Perfluoroethyl)thiazol-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-amine (CAS 1257329-76-2) is a chemical compound with the molecular formula C5H3F5N2S and a molecular weight of 218.15 g/mol. IUPAC name: 5-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-amine. InChIKey: SQJKZMLBJBUJKN-UHFFFAOYSA-N.
| Molecular formula | C5H3F5N2S |
|---|---|
| Molecular weight | 218.15 g/mol |
| IUPAC name | 5-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-amine |
| InChIKey | SQJKZMLBJBUJKN-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=N1)N)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)