CAS 125749-35-1 is the registry number for 2,3,7,8-Tetrabromo dibenzo-p-dioxin-13C12. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,3,7,8-tetrabromodibenzo-p-dioxin (CAS 125749-35-1) is a chemical compound with the molecular formula C12H4Br4O2 and a molecular weight of 511.69 g/mol. IUPAC name: 2,3,7,8-tetrabromodibenzo-p-dioxin. InChIKey: JZLQUWSWOJPCAK-WCGVKTIYSA-N.
| Molecular formula | C12H4Br4O2 |
|---|---|
| Molecular weight | 511.69 g/mol |
| IUPAC name | 2,3,7,8-tetrabromodibenzo-p-dioxin |
| InChIKey | JZLQUWSWOJPCAK-WCGVKTIYSA-N |
| SMILES | [13CH]1=[13C]2[13C](=[13CH][13C](=[13C]1Br)Br)O[13C]3=[13CH][13C](=[13C]([13CH]=[13C]3O2)Br)Br |
Computed by PubChem (NCBI)