CAS 1257535-09-3 appears in our catalog under these names: 2-Bromo-5-chloro-4-(trifluoromethyl)pyrimidine, 97%, 2-Bromo-5-chloro-4-(trifluoromethyl)pyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-bromo-5-chloro-4-(trifluoromethyl)pyrimidine (CAS 1257535-09-3) is a chemical compound with the molecular formula C5HBrClF3N2 and a molecular weight of 261.43 g/mol. IUPAC name: 2-bromo-5-chloro-4-(trifluoromethyl)pyrimidine. InChIKey: GEQXNSUVYCBSNY-UHFFFAOYSA-N.
| Molecular formula | C5HBrClF3N2 |
|---|---|
| Molecular weight | 261.43 g/mol |
| IUPAC name | 2-bromo-5-chloro-4-(trifluoromethyl)pyrimidine |
| InChIKey | GEQXNSUVYCBSNY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=N1)Br)C(F)(F)F)Cl |
Computed by PubChem (NCBI)