CAS 1257648-36-4 is the registry number for 6–Methyl–2–(naphthalen–2–yl)–1,3,6,2–dioxazaborocane–4,8–dione. Offered by: GLPBio. Available pack sizes: 1g, 25g, 5g.
6-methyl-2-naphthalen-2-yl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1257648-36-4) is a chemical compound with the molecular formula C15H14BNO4 and a molecular weight of 283.09 g/mol. IUPAC name: 6-methyl-2-naphthalen-2-yl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: IBHKLPUIBULVIU-UHFFFAOYSA-N.
| Molecular formula | C15H14BNO4 |
|---|---|
| Molecular weight | 283.09 g/mol |
| IUPAC name | 6-methyl-2-naphthalen-2-yl-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | IBHKLPUIBULVIU-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)